"""esbmtk: A general purpose Earth Science box model toolkit.
Copyright (C), 2020 Ulrich G. Wortmann
This program is free software: you can redistribute it and/or modify
it under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
This program is distributed in the hope that it will be useful,
but WITHOUT ANY WARRANTY; without even the implied warranty of
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
GNU General Public License for more details.
You should have received a copy of the GNU General Public License
along with this program. If not, see <https://www.gnu.org/licenses/>.
"""
from __future__ import annotations
import functools
import logging
import typing as tp
import matplotlib.pyplot as plt
import numpy as np
import numpy.typing as npt
# from numba import njit
if tp.TYPE_CHECKING:
from esbmtk import ExternalFunction, Model, Species, SpeciesProperties
np.set_printoptions(precision=4)
# declare numpy types
NDArrayFloat = npt.NDArray[np.float64]
[docs]
class ScaleError(Exception):
"""Custom Error Class."""
def __init__(self, message):
"""Initialize Class."""
message = f"\n\n{message}\n"
super().__init__(message)
[docs]
def rmtree(f) -> None:
"""Delete file or files if file is directory.
:param f: pathlib path object
"""
if f.is_file():
f.unlink()
else:
for child in f.iterdir():
rmtree(child)
f.rmdir()
[docs]
def phc(c: float) -> float:
"""Calculate concentration as pH.
c can be a number or numpy array
Parameters
----------
c : float
H+ concentration
Returns
-------
float
pH value
"""
import numpy as np
pH: float = -np.log10(c)
return pH
[docs]
def debug(func):
"""Print the function signature and return value."""
@functools.wraps(func)
def wrapper_debug(*args, **kwargs):
args_repr = [f"{float(repr(a)):.2e}\n" for a in args] # 1
kwargs_repr = [f"{k}={v!r}" for k, v in kwargs.items()] # 2
signature = ", ".join(args_repr + kwargs_repr) # 3
print(f"Calling {func.__name__}\n({signature})")
value = func(*args, **kwargs)
value = [f"{v:.2e}" for v in value]
print(f"\n{func.__name__!r} returned\n {value!r}\n") # 4
return value
return wrapper_debug
[docs]
def get_reservoir_reference(k: str, M: Model) -> tuple:
"""Get SpeciesProperties and Species handles.
Parameters
----------
k : str
with the initial flux name, e.g., M_F_A_db_DIC
M : Model
Model handle
Returns
-------
tuple
Species2Species, SpeciesProperties
Raises
------
ValueError
If reservoir_name is not of type ConnectionProperties or Species2Species
"""
from esbmtk import (
GasReservoir,
Reservoir,
Species,
Species2Species,
SpeciesProperties,
)
key_list = k[2:].split(".") # get model, reservoir & species name
if len(key_list) == 3: # Reservoir
_model_name, reservoir_name, species_name = key_list
if hasattr(M, reservoir_name):
obj = getattr(M, reservoir_name)
else:
raise ValueError(f"{reservoir_name} is not in the model")
if k[0:2] == "R_":
reservoir = obj
elif k[0:2] == "F_":
if isinstance(obj, Species | Reservoir):
reservoir = obj
elif isinstance(obj, Species2Species):
reservoir = obj
if isinstance(reservoir.source, GasReservoir):
species_name = obj.sink.name
else:
species_name = obj.source.name
else:
raise ValueError(
f"{obj.name} must be Species2Species", f"not {type(obj)}"
)
elif len(key_list) == 2: # (Gas)Species
_model_name, reservoir_name = key_list
reservoir = getattr(M, reservoir_name)
else:
raise ValueError("kl should look like this F_M.CO2_At")
species = getattr(M, species_name)
if not isinstance(species, SpeciesProperties):
raise NotImplementedError()
return reservoir, species
[docs]
def register_new_flux(ec, model_object, dict_key, dict_value) -> list:
"""Register a new flux object with a Species2Species instance.
Parameters
----------
ec : ExternalCode object
model_object : Species | Reservoir
instance to register with
dict_key : str
E.g., "M.A_db.DIC"
dict_value : str
id value, e.g., "db_cs2"
Returns
-------
list
list of Flux instances
"""
from .base_classes import Flux, Species
from .extended_classes import Reservoir
if isinstance(model_object, Reservoir):
spn = dict_key.split(".")[-1]
species_properties = getattr(model_object.mo, spn)
species = getattr(
model_object, species_properties.name
) # species to register flux with
elif isinstance(model_object, Species):
# in this case rg contains a species not a reservoirgroup
species_properties = model_object.species
rg = model_object.register # get associated reservoir
species = getattr(rg, species_properties.name)
else:
logging.debug(f" type(rg) = {type(model_object)}")
raise NotImplementedError
if not hasattr(species, "source"):
species.source = species_properties.name
ro = list()
# this also registers the flux with M.lof
num = ["", "_l"] if species.isotopes else [""]
for e in num:
logging.debug(f"ro= {model_object.full_name}, dv = {dict_value}, num = {num}")
f = Flux(
name=f"{dict_value}{e}",
species=species_properties,
rate=0,
register=species,
ftype=ec.ftype,
isotopes=species.isotopes,
id=f"{species.name}{e}",
)
ro.append(f)
ec.lof.append(f)
species.lof.append(f) # register flux
logging.debug(f"fname = {f.full_name}")
return ro
[docs]
def register_new_reservoir(r, sp, v):
"""Register a new reservoir."""
from .base_classes import Species
rt = Species( # create new reservoir
name=sp.name,
species=sp,
concentration=f"{v} mol/kg",
register=r,
volume=r.volume,
rtype="computed",
)
r.lor.append(rt)
return [rt]
[docs]
def register_return_values(ef: ExternalFunction, rg) -> None:
"""Register the return values of an external function instance.
Parameters
----------
ec : ExternalFunction
ExternalFunction Instance
rg : Reservoir | Species
The Resevoir or Reservoirgroup the external function is
associated with
Raises
------
ValueError
If the return value type is undefined
Check the return values of external function instances,
and create the necessary reservoirs, fluxes, or connections
if they are missing.
These fluxes are not associated with a connection Object
so we register the source/sink relationship with the
reservoir they belong to.
This fails for GasReservoir since they can have a 1:many
relatioship. The below is a terrible hack, it would be
better to express this with several connection
objects, rather than overloading the source attribute of the
GasReservoir class.
"""
from esbmtk import (
Flux,
Reservoir,
Sink,
SinkProperties,
Source,
SourceProperties,
Species,
Species2Species,
)
M = rg.mo
# go through each entry in ec.return_values
for line in ef.return_values:
if isinstance(line, dict):
dict_key = next(iter(line)) # get first key
dict_value = line[dict_key]
if dict_key[:2] == "F_": # is flux
"""The following code needs to extract the connection
object. Names must have the following scheme
M.Conn_CO2_At_to_H_b_CO2_H_b._F
"""
key_str = dict_key[2:].split(".")[1]
logging.debug(f"register_return_values key_str = {key_str}")
if hasattr(M, key_str):
o = getattr(M, key_str)
if isinstance(o, Flux):
o: list = [o]
elif isinstance(o, Species2Species):
o: list = o.lof # get flux handle
elif isinstance(
o,
Species
| Reservoir
| Sink
| SinkProperties
| Source
| SourceProperties,
):
# o: list = register_new_flux(ef, rg, dict_key[2:], dict_value)
o: list = register_new_flux(ef, o, dict_key[2:], dict_value)
else:
raise ValueError(f"No recipie for {type(o)}")
else:
raise ValueError(f"{key_str} is not part of the Model definition")
elif dict_key[:2] == "R_": # is reservoir
if dict_key[2:] in M.lor:
o: list = [getattr(M, dict_key)]
else:
r, sp = get_reservoir_reference(dict_key, M)
o: list = register_new_reservoir(r, sp, dict_value)
res = o[0]
if res.rtype == "computed": # register dummy flux
f = Flux(
species=sp, # SpeciesProperties handle
rate=0, # flux value
register=res, # is this part of a group?
isotopes=res.isotopes,
id=f"{res.full_name}_F",
ftype="computed",
)
res.lof.append(f)
o = [f]
elif dict_key[:2] == "C_": # is connection
raise NotImplementedError
elif dict_key[:2] == "N_": # is connection
pass
else:
raise ValueError(f"{dict_key[0:2]} is not defined")
elif isinstance(line, Species):
dict_value.ef_results = True
o = [dict_value]
else:
raise ValueError("This should not happen")
ef.lro.extend(o) # add to list of returned Objects
[docs]
def summarize_results(M: Model) -> dict():
"""Summarize all model results.
At t_max into a hirarchical
dictionary, where values are accessed in the following way:
results[basin_name][level_name][species_name]
e.g., result["A"]["sb"]["O2"]
"""
results = dict()
for r in M.lor:
species_name = r.name
basin_name = r.register.name[:1]
level_name = r.register.name[-2:]
species_value = r.c[-1]
if basin_name not in results:
results[basin_name] = {level_name: {species_name: species_value}}
elif level_name not in results[basin_name]:
results[basin_name][level_name] = {species_name: species_value}
elif species_name not in results[basin_name][level_name]:
results[basin_name][level_name][species_name] = species_value
return results
[docs]
def find_matching_strings(s: str, fl: list[str]) -> bool:
"""Test if all elements of fl occur in s.
Return True if yes,otherwise False
"""
return all(f in s for f in fl)
# def insert_into_namespace(name, value, name_space=globals()):
# name_space[name] = value
[docs]
def add_to(my_list, e):
"""Add element e to list l, but check if the entry already exist.
If so, throw exception. Otherwise add
"""
if e not in my_list: # if not present, append element
my_list.append(e)
[docs]
def get_plot_layout(obj):
"""Select a row, column layout.
Based on the number of objects to display. The expected argument
is a reservoir object which contains the list of fluxes in the reservoir
"""
noo = 1 + sum(f.plot == "yes" for f in obj.lof)
for _ in obj.ldf:
noo += 1
# noo = len(obj.lof) + 1 # number of objects in this reservoir
logging.debug(f"{noo} subplots for {obj.n} required")
size, geo = plot_geometry(noo)
return size, geo
[docs]
def plot_geometry(noo: int) -> tuple():
"""Define plot geometry based on number of objects to plot."""
if noo < 2:
geometry = [1, 1] # one row, one column
size = [5, 3] # width, height in inches
elif 1 < noo < 3:
geometry = [2, 1] # two rows, one column
size = [5, 6] # width, height in inches
elif 2 < noo < 5:
geometry = [2, 2] # two rows, two columns
size = [10, 6] # width, height in inches
elif 4 < noo < 7:
geometry = [3, 2] # 3 rows, 2 columns
size = [10, 9] # width, height in inches
elif 6 < noo < 10:
geometry = [4, 2] # 4 rows, 2 columns
size = [10, 12] # width, height in inches
elif 9 < noo < 13:
geometry = [5, 2] # 5 rows, 2 columns
size = [10, 15] # width, height in inches
elif 12 < noo < 16:
geometry = [6, 2] # 6 rows, 2 columns
size = [10, 18] # width, height in inches
else:
m = (
"plot geometry for more than 15 fluxes is not yet defined"
"Consider calling flux.plot individually on each flux in the reservoir"
)
raise ValueError(m)
return size, geometry
[docs]
def list_fluxes(self, name, i) -> None:
"""Echo all fluxes in the reservoir to the screen."""
for f in self.lof: # show the processes
for p in f.lop:
p.describe()
for f in self.lof:
f.describe(i) # print out the flux data
[docs]
def set_y_limits(ax: plt.Axes, obj: any) -> None:
"""Prevent the display or arbitrarily small differences."""
bottom, top = ax.get_ylim()
if (top - bottom) < obj.display_precision:
top = bottom + obj.display_precision
bottom -= obj.display_precision
ax.set_ylim(bottom, top)
[docs]
def is_name_in_list(n: str, my_list: list) -> bool:
"""Test if an object name is part of the object list."""
return any(e.full_name == n for e in my_list)
[docs]
def get_object_from_list(name: str, my_list: list) -> any:
"""Match a name to a list of objects.
Return the object
"""
match: bool = False
for o in my_list:
if o.full_name == name:
r = o
match = True
if match:
return r
else:
raise ValueError(f"Object = {o.full_name} has no matching flux {name}")
[docs]
def sort_by_type(my_list: list, t: list, m: str) -> list:
"""Divide a list by type into new lists.
This function will return a
list and it is up to the calling code to unpack the list
l is list with various object types
t is a list which contains the object types used for sorting
m is a string for the error function
"""
# from numbers import Number
lc = my_list.copy()
rl = []
for ot in t: # loop over object types
a = []
for e in my_list: # loop over list elements
if isinstance(e, ot):
a.append(e) # add to temporary list
lc.remove(e) # remove this element
rl.append(a) # save the temporary list to rl
# at this point, all elements of lc should have been processed
# if not, lc contains element which are of a different type
if lc:
raise TypeError(m)
return rl
[docs]
def get_object_handle(res: list, M: Model):
"""Test if the key is a global reservoir handle.
Or exists in the model namespace
:param res: tp.List of strings, or reservoir handles
:param M: Model handle
"""
r_list: list = []
if not isinstance(res, list):
res = [res]
for o in res:
if o in M.dmo: # is object known in global namespace
r_list.append(M.dmo[o])
elif o in M.__dict__: # or does it exist in Model namespace
r_list.append(getattr(M, o))
else:
print(f"{o} is not known for model {M.name}")
raise ValueError(f"{o} is not known for model {M.name}")
if len(r_list) == 1:
r_list = r_list[0]
return r_list
[docs]
def split_key(k: str, M: any) -> any | any | str:
"""Split the string k with letters _to_.
Test if optional id string is present
"""
if "_to_" not in k:
raise ValueError("Name must follow 'Source_to_Sink' format")
source = k.split("_to_")[0]
sinkandid = k.split("_to_")[1]
if "@" in sinkandid:
sink = sinkandid.split("@")[0]
cid = sinkandid.split("@")[1]
else:
sink = sinkandid
cid = ""
sink = get_object_handle(sink, M)
source = get_object_handle(source, M)
return (source, sink, cid)
[docs]
def make_dict(keys: list, values: list) -> dict:
"""Create a dictionary from a list and value, or from two lists."""
d = {}
if isinstance(values, list):
if len(values) == len(keys):
d: dict = dict(zip(keys, values, strict=False))
else:
raise ValueError("key and value list must be of equal length")
else:
values: list = [values] * len(keys)
d: dict = dict(zip(keys, values, strict=False))
return d
[docs]
def initialize_reservoirs(M: Model, box_dict: dict) -> list(Species):
"""Initialize one or more reservoirs.
Based
on the data in box_dict (see the example below).
Parameters
----------
M : Model
Model handle
box_dict : dict
dictionary with reservoir parameters
Returns
-------
tp.List
list of all Species objects in box_dict that are != particular
Raises
------
ValueError
If there are no Species objects in the dictionary
Example::
box_parameters = { # name: [[ud, ld ap], T, P, S]
# Atlantic Ocean
"M.A_sb": {
"g": [0, -100, A_ap],
"T": 20,
"P": 5,
"S": 34.7,
"c": {M.PO4: "2.1 mmol/kg",
M.DIC: "2.21 mmol/kg",
M.TA: "2.31 mmol/kg",
}
species_list = initialize_reservoirs(M, box_parameters)
Note: the first entry in the box_parameters dict must be a regular reservoir, not
a Source or Sink.
"""
from esbmtk import Reservoir, SinkProperties, SourceProperties, SpeciesProperties
# loop over reservoir names
for box_name, value in box_dict.items():
match value.get("ty"): # type is given
case "Source":
SourceProperties(
name=box_name,
species=value["sp"],
delta=value.get("d", {}),
isotopes=value.get("i", {}),
register=M,
)
case "Sink":
SinkProperties(
name=box_name,
species=value["sp"],
delta=value.get("d", {}),
isotopes=value.get("i", {}),
register=M,
)
case _: # default to creating a reservoir
_rg = Reservoir(
name=box_name,
geometry=value["g"],
concentration=value.get("c", "0 mol/kg"),
delta=value.get("d", {}),
isotopes=value.get("i", {}),
plot=value.get("p", {}),
seawater_parameters={
"temperature": value["T"],
"pressure": value["P"],
"salinity": value["S"],
},
register=M,
)
first_key = list(box_dict.keys())[0]
b_type = box_dict[first_key].get("ty")
if b_type == "Source" or b_type == "Sink":
raise ValueError(
"\nThe first entry in the box_parameter dict must be a regular reservoir\n"
"You likely started with a Source or Sink\n"
"Check your arguments to initialize_reservoirs()\n"
)
species_dict = box_dict[first_key].get("c", "None")
if isinstance(species_dict, dict):
species_list = list(species_dict.keys())
if not isinstance(species_list[0], SpeciesProperties):
raise ValueError(
f"{species_list[0]} must be of type SpeciesProperties",
f"not {type(species_list[0])}",
)
else:
raise ValueError("No species in species dict!")
# remove species that are bot affected by transport processes
for s in species_list:
if s.stype == "particulate" or s.stype == "length":
species_list.remove(s)
return species_list
[docs]
def build_concentration_dicts(cd: dict, bg: dict) -> dict:
"""Build a dict which can be used by create_reservoirs.
:param bg: dict where the box_names are dict keys.
:param cd: dictionary
with the following format::
cd = {
# species: [concentration, isotopes]
PO4: [Q_("2.1 * umol/liter"), False],
DIC: [Q_("2.1 mmol/liter"), False],
}
This function returns a new dict in the following format
# box_names: [concentrations, isotopes]
d= {"bn": [{PO4: .., DIC: ..},{PO4:False, DIC:False}]}
"""
if isinstance(bg, dict):
box_names: list = bg.keys()
elif isinstance(bg, list):
box_names: list = bg
elif isinstance(bg, str):
box_names: list = [bg]
else:
raise ValueError("This should never happen")
icd: dict = {}
td1: dict = {} # temp dictionary
td2: dict = {} # temp dictionary
td3: dict = {} # temp dictionary
# create the dicts for concentration and isotopes
for k, v in cd.items():
td1[k] = v[0]
td2[k] = v[1]
td3[k] = v[2]
# box_names: tp.List = bg.keys()
for bn in box_names: # loop over box names
icd[bn] = [td1, td2, td3]
return icd
[docs]
def calc_volumes(bg: dict, M: any, h: any) -> list:
"""Calculate volume contained in a given depth interval.
bg is a dictionary in the following format::
bg={
"hb": (0.1, 0, 200),
"sb": (0.9, 0, 200),
}
where the key must be a valid box name, the first entry of the list denoted
the areal extent in percent, the second number is upper depth limit, and last
number is the lower depth limit.
M must be a model handle
h is the hypsometry handle
The function returns a list with the corresponding volumes
"""
# from esbmtk import hypsometry
v: list = [] # list of volumes
for v in bg.values():
a = v[0]
u = v[1]
ll = v[2]
v.append(h.volume(u, ll) * a)
return v
[docs]
def get_longest_dict_entry(d: dict) -> int:
"""Get length of each item in the connection dict."""
l_length = 0 # length of longest list
p_length = 0 # length of single parameter
nl = 0 # number of lists
ll = []
# we need to cover the case where we have two lists of different length
# this happens if we have a long list of tuples with matched references,
# as well as a list of species
for v in d.values():
if isinstance(v, list):
nl = nl + 1
if len(v) > l_length:
l_length = len(v)
ll.append(l_length)
else:
p_length = 1
if nl > 1 and ll.count(l_length) != len(ll):
raise ValueError("Mapping for multiple lists is not supported")
if l_length > 0 and p_length == 0:
case = 0 # Only lists present
if l_length == 0 and p_length == 1:
case = 1 # Only parameters present
if l_length > 0 and p_length == 1:
case = 2 # Lists and parameters present
return case, l_length
[docs]
def convert_to_lists(d: dict, my_list: int) -> dict:
"""Expand mixed dict entries.
(i.e. list and single value) such that they are all lists
of equal length
"""
cd = d.copy()
for k, v in cd.items():
if not isinstance(v, list):
p = [v for _ in range(my_list)]
d[k] = p
return d
[docs]
def get_sub_key(d: dict, i: int) -> dict:
"""Take a dict which has where the value is a list.
Return the key with the n-th value of that list
"""
return {k: v[i] for k, v in d.items()}
[docs]
def expand_dict(d: dict, mt: str = "1:1") -> int:
"""Determine dict structure.
in case we have mutiple connections with mutiple species, the
default action is to map connections to species (t = '1:1'). If
you rather want to create mutiple connections (one for each
species) in each connection set t = '1:N'
"""
# loop over dict entries
# ck = connection key
# cd = connection dict
r: dict = {} # the dict we will return
for ck, cd in d.items(): # loop over connections
rd: dict = {} # temp dict
nd: dict = {} # temp dict
case, length = get_longest_dict_entry(cd)
if isinstance(ck, tuple):
# assume 1:1 mapping between tuple and connection parameters
if mt == "1:1":
# prep dictionaries
if case == 0:
nd = cd
elif case == 1: # only parameters present. Expand for each tuple entry
length = len(ck)
nd = convert_to_lists(cd, length)
elif case == 2: # mixed list present, Expand list
nd = convert_to_lists(cd, length)
# for each connection group in the tuple
if length != len(ck):
message = (
f"The number of connection properties ({length})\n"
f"does not match the number of connection groups ({len(ck)})\n"
f"did you intend to do a 1:N mapping?"
)
raise ValueError(message)
# map property dicts to connection group names
i = 0
for t in ck:
rd[t] = get_sub_key(nd, i)
i = i + 1
elif mt == "1:N": # apply each species to each connection
if case == 0:
nd = cd
elif case == 1: # only parameters present. Expand for each tuple entry
length = len(ck)
nd = convert_to_lists(cd, length)
elif case == 2: # mixed list present, Expand list
nd = convert_to_lists(cd, length)
for t in ck: # apply the entire nd dict to all connections
rd[t] = nd
else:
raise ValueError(f"{mt} is not defined. must be '1:1' or '1:N'")
else:
if case in [0, 1]: # only lists present, case 3
nd = cd
elif case == 2: # list and parameters present case 4
nd = convert_to_lists(cd, length)
rd[ck] = nd
# update the overall dict and move to the next entry
# r |= rd
r.update(rd)
return r
[docs]
def create_bulk_connections(ct: dict, M: Model, mt: int = "1:1") -> dict:
"""Create connections from a dictionary.
The dict can have the following format:
mt = mapping type. See below for explanation
# na: names, tuple or str. If lists, all list elements share the same properties
# sp: species list or species
# ty: type, str
# ra: rate, Quantity
# sc: scale, Number
# re: reference, optional
# al: epsilon, optional
# de: delta, optional
# bp: bypass, see scale_with_flux
# si: signal
# mx: True, optional defaults to False. If set, it will create forward and backward fluxes (i.e. mixing)
There are 6 different cases how to specify connections
Case 1 One connection, one set of parameters
ct1 = {"sb2hb": {"ty": "scale", 'ra'....}}
Case 2 One connection, one set of instructions, one subset with multiple parameters
This will be expanded to create connections for each species
ct2 = {"sb2hb": {"ty": "scale", "sp": ["a", "b"]}}
Case 3 One connection complete set of multiple characters. Similar to case 2,
but now all parameters are given explicitly
ct3 = {"sb2hb": {"ty": ["scale", "scale"], "sp": ["a", "b"]}}
Case 4 Multiple connections, one set of parameters. This will create
identical connection for "sb2hb" and "ib2db"
ct4 = {("sb2hb", "ib2db"): {"ty": "scale", 'ra': ...}}
Case 5 Multiple connections, one subset of multiple set of parameters. This wil
create a connection for species 'a' in sb2hb and with species 'b' in ib2db
ct5 = {("sb2hb", "ib2db"): {"ty": "scale", "sp": ["a", "b"]}}
Case 6 Multiple connections, complete set of parameters of multiple parameters
Same as case 5, but now all parameters are specified explicitly
ct6 = {("sb2hb", "ib2db"): {"ty": ["scale", "scale"], "sp": ["a", "b"]}}
The default interpretation for cases 5 and 6 is that each list
entry corresponds to connection. However, sometimes we want to
create multiple connections for multiple entries. In this case
provide the mt='1:N' parameter which will create a connection for
each species in each connection group. See the below example.
It is easy to shoot yourself in the foot. It is best to try the above first with
some simple examples, e.g.,
from esbmtk import expand_dict
ct2 = {"sb2hb": {"ty": "scale", "sp": ["a", "b"]}}
It is best to use the show_dict function to verify that your input
dictionary produces the correct results!
"""
from esbmtk.utility_functions import create_connection, expand_dict
# expand dictionary into a well formed dict where each connection
# has a fully formed entry
c_ct = expand_dict(ct, mt=mt)
# loop over dict entries and create the respective connections
for k, v in c_ct.items():
if isinstance(k, tuple): # loop over names in tuple
for c in k:
create_connection(c, v, M)
elif isinstance(k, str):
create_connection(k, v, M)
else:
raise ValueError(f"{c} must be string or tuple")
return c_ct
[docs]
def create_connection(n: str, p: dict, M: Model) -> None:
"""Create a connection group.
It is assumed that all rates are in liter/year or mol per year. This may
not be what you want or need.
:param n: a connection key. if the mix flag is given interpreted as mixing
a connection between sb and db and thus create connections in both
directions
:param p: a dictionary holding the connection properties
:param M: the model handle
"""
from esbmtk import Q_, ConnectionProperties
# get the reservoir handles by splitting the key
source, sink, cid = split_key(n, M)
# create default connections parameters and replace with values in
# the parameter dict if present.
los = list(p["sp"]) if isinstance(p["sp"], list) else [p["sp"]]
ctype = p.get("ty", "None")
scale = p.get("sc", 1)
rate = Q_("0 mol/a") if "ra" not in p else p["ra"]
ref_flux = p.get("re", "None")
epsilon = p.get("ep", "None")
# alpha = p.get("al", "None")
delta = p.get("de", "None")
cid = f"{cid}"
bypass = p.get("bp", "None")
# species = p.get("sp", "None")
signal = p.get("si", "None")
if isinstance(scale, Q_):
if scale.check(["dimensionless"]):
scale = scale.magnitude
else:
scale = scale.to(M.f_unit).magnitude
# expand arguments
ctype = make_dict(los, ctype)
scale = make_dict(los, scale) # get rate from dictionary
rate = make_dict(los, rate)
ref_flux = make_dict(los, ref_flux)
epsilon = make_dict(los, epsilon)
delta = make_dict(los, delta)
bypass = make_dict(los, bypass)
signal = make_dict(los, signal)
name = f"{M.name}.ConnGrp_{source.name}_to_{sink.name}"
if f"{name}" in M.lmo: # Test if CG exists
cg = getattr(M, name.split(".")[1]) # retriece CG object
cg.add_connections(
source=source,
sink=sink,
ctype=ctype,
scale=scale, # get rate from dictionary
rate=rate,
ref_flux=ref_flux,
epsilon=epsilon,
delta=delta,
bypass=bypass,
register=M,
signal=signal,
id=cid, # get id from dictionary
)
else: # Create New ConnectionProperties
cg = ConnectionProperties(
source=source,
sink=sink,
ctype=ctype,
scale=scale, # get rate from dictionary
rate=rate,
ref_flux=ref_flux,
epsilon=epsilon,
delta=delta,
bypass=bypass,
register=M,
signal=signal,
id=cid, # get id from dictionary
)
[docs]
def get_name_only(o: any) -> any:
"""Test if item is an esbmtk type.
If yes, extract the name
"""
from esbmtk import Flux, Reservoir, Species, SpeciesProperties
return (
o.full_name
if isinstance(o, Flux | Species | Reservoir | SpeciesProperties)
else o
)
[docs]
def get_simple_list(my_list: list) -> list:
"""Return a list.
Which only has the full name
rather than all the object properties
"""
return [get_name_only(e) for e in my_list]
[docs]
def show_dict(d: dict, mt: str = "1:1") -> None:
"""Show dict entries in an organized manner."""
from esbmtk import expand_dict, get_name_only, get_simple_list
ct = expand_dict(d, mt)
for _ck, cv in ct.items():
for _pk, pv in cv.items():
get_simple_list(pv) if isinstance(pv, list) else get_name_only(pv)
[docs]
def find_matching_fluxes(my_list: list, filter_by: str, exclude: str) -> list:
"""Loop over all reservoirs in my_list.
And extract the names of all fluxes
which match the filter string. Return the list of names (not objects!)
"""
lof: set = set()
for r in my_list:
for f in r.lof:
if filter_by in f.full_name and exclude not in f.full_name:
lof.add(f)
return list(lof)
[docs]
def reverse_key(key: str) -> str:
"""Reverse a connection key e.g., sb2db@POM becomes db2sb@POM."""
left = key.split("@")
left = left[0]
rs = left.split("_to_")
r1 = rs[0]
r2 = rs[1]
return f"{r2}_to_{r1}"
[docs]
def reverse_tick_labels_factory(max_tick_value):
"""Reverse the label of the x-axis ticks but not the data.
Usage:
From matplotlib.ticker import FuncFormatter
ax.xaxis.set_major_formatter(FuncFormatter(reverse_tick_labels_factory(x_max)))
where xmax = max value on the x-axis
"""
def formatter(x, pos):
return f"{max_tick_value - x:.1f}"
return formatter
[docs]
def get_connection_keys(
f_list: set,
ref_id: str,
target_id: str,
inverse: bool,
exclude: str,
) -> list[str]:
"""Extract connection keys from set of flux names.
Replace ref_id with
target_id so that the key can be used in create_bulk_connnections()
:param f_list: a set with flux objects
:param ref_id: string with the reference id
:param target_id: string with the target_id
:param inverse: Bool, optional, defaults to false
:return cnc_l: a list of connection keys (str)
The optional inverse parameter, can be used where in cases where the
flux direction needs to be reversed, i.e., the returned key will not read
sb2db@POM, but db2s@POM
"""
cnc_l: list = [] # list of connection keys
for f in f_list:
# get connection and flux name
fns = f.full_name.split(".")
cnc = fns[1][3:] # get key without leadinf C_
if inverse:
cnc = reverse_key(cnc)
cnc.replace(ref_id, target_id)
# create new cnc string
cnc = f"{cnc}_to_{target_id}"
cnc_l.append(cnc)
return cnc_l
[docs]
def gen_dict_entries(M: Model, **kwargs) -> tuple(tuple, list):
"""Find all fluxes that contain the reference string.
Create a new
Species2Species instance that connects the flux matching ref_id, with a flux
matching target_id. The function will a tuple containig the new connection
keys that can be used by the create bulk_connection() function. The second
return value is a list containing the reference fluxes.
The optional inverse parameter, can be used where in cases where the flux
direction needs to be reversed, i.e., the returned key will not read
sb_to_dbPOM, but db_to_sb@POM
:param M: Model or list
:param kwargs: keyword dictionary, known keys are ref_id, and raget_id, inverse
:return f_list: tp.List of fluxes that match ref_id
:return k_tuples: tuple of connection keys
"""
from esbmtk import Model
ref_id = kwargs["ref_id"]
target_id = kwargs["target_id"]
inverse = kwargs.get("inverse", False)
exclude_str = kwargs.get("exclude", "None")
# find matching fluxes
if isinstance(M, Model):
f_list: list = find_matching_fluxes(
M.loc,
filter_by=ref_id,
exclude=exclude_str,
)
elif isinstance(M, list):
f_list: list = find_matching_fluxes(
M,
filter_by=ref_id,
exclude=exclude_str,
)
else:
raise ValueError(f"gen_dict_entries: M must be list or Model, not {type(M)}")
k_tuples: list = get_connection_keys(
f_list,
ref_id,
target_id,
inverse,
exclude_str,
)
return tuple(k_tuples), f_list
[docs]
def build_ct_dict(d: dict, p: dict) -> dict:
"""Build a connection dictionary.
From a dict containing connection
keys, and a dict containing connection properties. This is most
useful for connections which a characterized by a fixed rate but
apply to many species. E.g., mixing fluxes in a complex model etc.
"""
# a = {k: {"sc": v} | p for k, v in d.items()}
a = {}
for k, v in d.items():
a[k] = p.copy()
a[k]["sc"] = v
return a
[docs]
def get_string_between_brackets(s: str) -> str:
"""Parse string and extract substring between square brackets."""
s = s.split("[")
if len(s) < 2:
raise ValueError(f"Column header {s} must include units in square brackets")
s = s[1]
s = s.split("]")
if len(s) < 2:
raise ValueError(f"Column header {s} must include units in square brackets")
return s[0]
[docs]
def check_for_quantity(quantity, unit):
r"""Check if keyword is quantity or string an convert as necessary.
- If input is a string, convert string into a quantity
- If input is a quantity, do nothing
- if input is a number, convert to default quantity
Parameters
----------
quantity : str | quantity | float | int
e.g., "12 m/s", or 12,
unit : str
desired unit for keyword, e.g., "m/s"
Returns
-------
Q\_
Returns a Quantity
Raises
------
ValueError
if keywword is neither number, str or quantity
"""
from esbmtk import Q_
if isinstance(quantity, str):
quantity = Q_(quantity)
elif isinstance(quantity, float | int):
quantity = Q_(f"{quantity} {unit}")
elif not isinstance(quantity, Q_):
raise ValueError("kw must be string, number or Quantity")
return quantity
[docs]
def map_units(obj: any, v: any, *args) -> float:
"""Parse v to see if it is a string.
If yes, map to quantity.
parse v to see if it is a quantity, if yes, map to model units
and extract magnitude, assign mangitude to return value
if not, assign value to return value
:param obj: connection object
:param v: input string/number/quantity
:args: tp.List of model base units
:returns: number
:raises ScaleError: if input cannot be mapped to a model unit
"""
from . import Q_
m: float = 0
match: bool = False
# test if string, map to quantity if yes
if isinstance(v, str):
v = Q_(v)
# test if we find a matching dimension, map if true
if isinstance(v, Q_):
for q in args:
if v.dimensionality == q.dimensionality:
m = v.to(q).magnitude
match = True
if not match:
raise ScaleError(
f"Missing base units for the scale in {obj.full_name}, this should not happen"
f"complain to the program author"
)
else: # no quantity, so it should be a number
m = v
if not isinstance(m, int | float):
raise ValueError(f"m is {type(m)}, must be float, v={v}. Something is fishy")
return m
def __find_flux__(reservoirs: list, full_name: str):
"""Find a Flux object based on its full_name.
PRECONDITIONS: full_name must contain the full_name of the Flux
Parameters
----------
reservoirs: tp.List containing all reservoirs
full_name: str specifying the full name of the flux (boxes.flux_name)
"""
needed_flux = None
for res in reservoirs:
for flux in res.lof:
if flux.full_name == full_name:
needed_flux = flux
break
if needed_flux is not None:
break
if needed_flux is None:
raise NameError(
f"add_carbonate_system: Flux {full_name} cannot be found in any of the reservoirs in the Model!"
)
return needed_flux
def __checktypes__(allwed_keys: dict[any, any], provided_keys: dict[any, any]) -> None:
"""Look up the allowed data type for this key in allowed_keys.
av = dictinory with the allowed input keys and their type
pv = dictionary with the user provided key-value data
"""
k: any
v: any
# loop over provided keywords
for k, v in provided_keys.items():
# check av if provided value v is of correct type
if allwed_keys[k] != any and not isinstance(v, allwed_keys[k]):
raise TypeError(
f"{type(v)} is the wrong type for '{k}', should be '{allwed_keys[k]}'"
)
[docs]
def dict_alternatives(d: dict, e: str, a: str) -> any:
"""Use dictionary =d=, an expression =e=, and an alternative expression =a=.
Returns the value associated with
either =a= or =e= in the dictionary =d=.
:param d: A dictionary.
:param e: The first expression to check.
:param a: The alternative expression to check.
:returns r: The value associated with either =a= or =e= in the dictionary =d=.
:raises ValueError: If neither =a= nor =e= are found in the dictionary.
"""
if a in d:
r = d[a]
elif e in d:
r = d[e]
else:
raise ValueError(f"You must specify either {e} or {a} \nd = {d}")
return r
def __checkkeys__(lrk: list, lkk: list, kwargs: dict) -> None:
"""Check if the mandatory keys are present.
lrk = list of required keywords
lkk = list of all known keywords
kwargs = dictionary with key-value pairs
"""
k: str
# test if the required keywords are given
for k in lrk: # loop over required keywords
if isinstance(k, list): # If keyword is a list
s: int = 0 # loop over allowed substitutions
for e in k: # test how many matches are in this list
if (
e in kwargs
and not isinstance(e, np.ndarray | list)
and kwargs[e] != "None"
):
s = s + 1
if s > 1: # if more than one match
raise ValueError(f"You need to specify exactly one from this list: {k}")
elif k not in kwargs:
raise ValueError(f"You need to specify a value for {k}")
tl: list[str] = [k for k, v in lkk.items()]
# test if we know all keys
for k in kwargs:
if k not in lkk:
raise ValueError(f"{k} is not a valid keyword. \n Try any of \n {tl}\n")
def __addmissingdefaults__(lod: dict, kwargs: dict) -> dict:
"""Test if the keys in lod exist in kwargs.
otherwise add them with the default values from lod
"""
new: dict = {}
if lod:
for k, v in lod.items():
if k not in kwargs:
new[k] = v
# kwargs |= new
kwargs.update(new)
return kwargs
[docs]
def data_summaries(
M: Model,
species_names: list,
box_names: list,
register_with="None",
) -> list:
r"""Group results by species and Reservoirs.
:param M: model instance
:param species_names: tp.List of species instances
:param box_names: tp.List of Reservoir instances
:param register_with: defaults to M
:returns pl: a list of datafield instances to be plotted
Note: because pl is a list, you need to expand it before
using it in the plot method. Either use
M.plot(pl)
or
M.plot([\*pl])
If you call a plot with many subfigures, use pl like this:
M.plot([o1, o2, \*pl])
"""
from esbmtk import DataField, VectorData
if register_with == "None":
register_with = M
pl = []
for sp in species_names:
data_list = []
label_list = []
t = ""
for b in box_names:
if isinstance(b, VectorData):
# FIXME: Should a be b????
data_list.append(a)
label_list.append(a.full_name)
t = b.name
if hasattr(b, f"{sp.name}"):
a = getattr(b, f"{sp.name}") # this is a reservoir
y1, unit, d_scale = a.get_conversion_unit_information()
data_list.append(y1)
label_list.append(f"{b.name}")
t = sp.display_as if hasattr(sp, "display_as") else sp.name
df = DataField(
name=f"{sp.name}_df",
register=register_with,
x1_data=M.time,
y1_data=data_list,
y1_label=label_list,
y1_legend=f"{sp.name} [{unit}]",
x1_as_time=True,
title=t,
)
pl.append(df)
""" check if species has isotope data. This needs to be done
after the above loop, so that the data is in its own datafield.
"""
data_list = []
label_list = []
for b in box_names:
if hasattr(b, f"{sp.name}"):
a = getattr(b, f"{sp.name}")
if a.isotopes:
unit = f"{a.species.element.d_label}"
data_list.append(a.d)
label_list.append(f"{b.name}")
if len(data_list) > 0:
df = DataField(
name=f"d_{sp.name}_df",
register=register_with,
x1_data=M.time,
y1_data=data_list,
y1_label=label_list,
y1_legend=f"{unit} [{sp.element.d_scale}]",
x1_as_time=True,
title=sp.element.d_label,
)
pl.append(df)
return pl
[docs]
def fractionate_with_epsilon(
epsilon: float,
source_c: float,
source_l: float,
sink_c: float,
) -> float:
"""Calculate how a given epsilon would affect the downstream isotoe ratio."""
alpha = epsilon / 1000 + 1 # get alpha
sink_l = (alpha * source_l * sink_c) / (alpha * source_l - source_l + source_c)
return sink_l
# @njit(fastmath=True)
[docs]
def get_l_mass(m: float, d: float, r: float) -> float:
"""Get mass of light isotope.
:param m: mass or concentration
:param d: delta value
:param r: isotopic reference ratio
return mass or concentration of the light isotope
"""
return (1000.0 * m) / ((d + 1000.0) * r + 1000.0)
[docs]
def get_delta_h(R) -> float:
"""Calculate the delta of a flux or reservoir.
:param R: Species or Flux handle
returns d as vector of delta values
R.c = total concentration
R.l = concentration of the light isotope
"""
from esbmtk import Flux, GasReservoir, Species
r = R.species.r # reference ratio
if isinstance(R, Species | GasReservoir):
d = np.where(R.l > 0, 1e3 * ((R.c - R.l) / R.l - r) / r, 0)
elif isinstance(R, Flux):
d = np.where(R.l > 0, 1e3 * ((R.m - R.l) / R.l - r) / r, 0)
else:
raise ValueError(
f"{R.full_name} must be of type Flux or Species, not {type(R)}"
)
return d
[docs]
def get_delta_from_concentration(c, li, r):
"""Calculate the delta from the mass of light and heavy isotope.
:param c: total mass/concentration
:param l: light isotope mass/concentration
:param r: reference ratio
"""
h = c - li
d = 1000 * (h / li - r) / r
return d
[docs]
def get_imass(m: float, d: float, r: float) -> [float, float]:
"""Calculate the isotope masses from bulk mass and delta value.
Arguments are m = mass, d= delta value, r = abundance ratio
species
"""
li: float = (1000.0 * m) / ((d + 1000.0) * r + 1000.0)
h: float = m - li
return [li, h]
# @njit(fastmath=True)
[docs]
def get_delta(li: NDArrayFloat, h: NDArrayFloat, r: float) -> NDArrayFloat:
"""Calculate the delta from the mass of light and heavy isotope.
:param l: light isotope mass/concentration
:param h: heavy isotope mass/concentration
:param r: reference ratio
:return : delta
"""
return 1000 * (h / li - r) / r
# @njit(fastmath=True)
[docs]
def get_new_ratio_from_alpha(
ref_mass: float, # reference mass
ref_l: float, # reference light istope
a: float, # fractionation factor
) -> [float, float]:
"""Calculate the effect of the istope fractionation factor alpha.
For the ratio between the mass of the light isotope devided by the total mass
Note that alpha needs to be given as fractional value, i.e., 1.07 rather
than 70 (i.e., (alpha-1) * 1000
"""
new_ratio = -ref_l / (a * ref_l - a * ref_mass - ref_l) if ref_mass > 0.0 else 0.0
return new_ratio
[docs]
def register_user_function(M: Model, lib_name: str, func_name: str | list) -> None:
"""Register user supplied library and function with the model.
Parameters
----------
M : Model
Model handle
lib_name : str
name of python file that contains the function
func_name : str | list
Name of one or more user supplied function(s)
"""
import pathlib as pl
import sys
if isinstance(func_name, str):
func_name = [func_name]
cwd: pl.Path = pl.Path.cwd() # get the current working
if cwd not in sys.path:
sys.path.append(cwd)
for f in func_name:
M.luf[f] = [lib_name, cwd]
[docs]
def create_reservoirs():
"""Raise Error on use."""
raise NotImplementedError("create_reservoirs is no longer supported")
[docs]
def check_for_NaN(a: NDArrayFloat) -> bool:
"""Test if a contains NaN values."""
return np.isnan(a).any()
[docs]
def warn_if_non_numeric(df):
"""Warn about non numeric data in dataframe.
Checks all columns in the DataFrame for non-numeric values.
Prints warnings with the row indices and offending values for each column.
Args:
df (pd.DataFrame): The DataFrame to check.
"""
import pandas as pd
ed = False
for col in df.columns:
numeric_col = pd.to_numeric(df[col], errors="coerce")
non_numeric_mask = numeric_col.isna() & df[col].notna()
if non_numeric_mask.any():
bad_indices = df.index[non_numeric_mask].tolist()
print(
f"Warning: Non-numeric data found in column '{col}' at rows: {bad_indices}"
)
print(df.loc[bad_indices, col])
ed = True
return ed
NDArrayFloat = npt.NDArray[np.float64]
# if tp.TYPE_CHECKING:
# from esbmtk import Model, SpeciesProperties
[docs]
def create_connections_from_flux_list(
model: Model,
flux_list: list,
target_id: str,
species: SpeciesProperties,
scale: float,
**kwargs: dict,
) -> None:
"""
Create Species2Species connections from an existing list of flux objects.
This function constructs coupling relationships between reservoir species
based on a list of reference fluxes. It interprets flux naming conventions
to infer source/sink reservoirs unless explicitly overridden.
Parameters
----------
model : Model
The ESBMTK model instance containing reservoir groups.
flux_list : list
List of flux objects used as references for constructing connections.
Each flux is expected to have at least an ``id`` attribute following
a naming convention such as ``A_sb_2_A_ib_POP_ex``.
target_id : str
Identifier used to label the resulting connection group.
species : SpeciesProperties
Species object defining which tracer is being coupled (e.g. DIC, PO4).
scale : int or float
Scaling factor applied to the reference flux when constructing the
Species2Species coupling.
Other Parameters
----------------
source : str, optional
Source selection mode or explicit source name.
Options:
- "auto" (default): infer source from flux name
- "from_sink": infer source from sink portion of flux name
- str: explicit model attribute name for source reservoir group
sink : str or ReservoirGroup, optional
Sink selection mode or explicit sink identifier.
Options:
- "auto" (default): infer sink from flux name
- str: explicit sink reservoir group name
delta : float, optional
Isotopic fractionation passed to Species2Species.
epsilon : float, optional
Additional isotopic or parameter modifier passed to Species2Species.
Returns
-------
None
The function modifies the model by adding connection objects.
"""
import logging
from esbmtk import Species2Species
source_arg = kwargs.get("source", "auto")
sink_arg = kwargs.get("sink", "auto")
delta = kwargs.get("delta", None)
epsilon = kwargs.get("epsilon", None)
bypass = "None"
if len(flux_list) < 1:
raise ValueError("Flux_list")
logging.debug("# --- create_connections_from_flux_list ---- #") # ruff:ignore[root-logger-call]
for f in flux_list:
if source_arg == "auto":
# Extract source and sink, assuming that the flux name
# looks like: "A_sb_2_A_ib_POP_ex"
source_name = "_".join(f.id.split("_")[:2])
elif source_arg == "from_sink":
source_name = "_".join(f.full_name.split("_")[4:6])
else:
source_name = source_arg.name
if sink_arg == "auto":
sink_name = "_".join(f.id.split("_")[3:5])
else:
sink_name = sink_arg
bypass = "sink"
# get reservoirgroups
source_reservoir_group_handle = getattr(model, source_name)
sink_reservoir_group_handle = getattr(model, sink_name)
# Reservoir objects
source = getattr(source_reservoir_group_handle, species.name)
sink = getattr(sink_reservoir_group_handle, species.name)
c = Species2Species(
source=source,
sink=sink,
species=species,
ctype="scale_with_flux",
ref_flux=f, # <-- indexed reference
scale=scale,
delta=delta,
epsilon=epsilon,
id=f"C_{source_name}_to_{sink_name}_{target_id}",
bypass=bypass,
)
logging.debug(f"Created {c.full_name}")
logging.debug("\n") # ruff:ignore[root-logger-call]
# if target_id == "PIC_DIC_shelf":
# breakpoint()
[docs]
def create_weathering_fluxes(
model: Model,
species: SpeciesProperties,
area_dict: dict,
ref_flux_name: str,
scale: float,
delta: float | None = None,
alpha: float | None = None,
**kwargs: dict,
) -> None:
"""
Create Species2Species connections representing weathering fluxes.
This function generates coupling terms between a crustal or atmospheric
source reservoir and basin sink reservoirs, scaled by basin area and a
reference flux.
Parameters
----------
model : Model
ESBMTK model instance containing reservoirs and flux definitions.
species : SpeciesProperties
Species being transported (e.g. DIC, alkalinity).
area_dict : dict
Dictionary mapping basin names to their surface areas.
ref_flux_name : str
Name of the reference flux used.
scale : int or float
Scaling factor applied to all basin weathering fluxes.
delta : float, optional
Optional isotopic fractionation parameter passed to Species2Species.
alpha : float, optional
Optional isotopic fractionation parameter passed to Species2Species.
Other Parameters
----------------
source : str, optional
Source reservoir selection mode.
Options:
- "crust" (default): use crustal reservoir (Fw.<species>)
- "atmosphere": use atmospheric reservoir (e.g., CO2_At for DIC)
Returns
-------
None
The function modifies the model by adding connection objects.
Notes
-----
- Weathering fluxes are constructed per basin.
- Source selection currently supports crust and atmosphere only.
Examples
--------
>>> create_weathering_fluxes(model, DIC, areas, "weathering_silicate", 1.0)
"""
import logging
from operator import attrgetter
from esbmtk import Species2Species
source_arg = kwargs.get("source", "crust")
logging.debug("# --- create_connections_from_flux_list ---- #")
for basin, area in area_dict.items():
if source_arg == "crust":
# FIXME: query list of sources
source = attrgetter(f"Fw.{species.name}")(model)
elif source_arg == "atmosphere":
if species.name == "DIC":
# FIXME: query list of gas reservoirs
source = getattr(model, "CO2_At")
sink = attrgetter(f"{basin}.{species.name}")(model)
cid = f"{sink.full_name.split('.')[1]}.{species.name}_{ref_flux_name}_weathering_x"
if model.debug:
logging.debug(f"source = {source.full_name}, type = {type(source)}")
logging.debug(f"sink = {sink.full_name}, type = {type(sink)}")
logging.debug(f"species = {species.full_name}, type = {type(species)}")
logging.debug(f"ref_flux = {ref_flux_name}")
logging.debug(f"id = {cid}")
# ---------------- Species2Species ---------------- #
kwargs_s2s = {
"ctype": "scale_with_flux",
"source": source,
"sink": sink,
"species": species,
"ref_flux": ref_flux_name,
"scale": area * scale,
"id": cid,
}
# only forward if provided
if delta is not None:
kwargs_s2s["delta"] = delta
if alpha is not None:
kwargs_s2s["alpha"] = alpha
Species2Species(**kwargs_s2s)
# c.name = (f"C_{source.name}_to_{sink.name}_{species.name}_{c.id}",)
# c.full_name = (f"M.C_{source.name}_to_{sink.name}_{species.name}_{c.id}",)
# logging.debug(f"Created {c.full_name}")
# breakpoint()
logging.debug("\n")
[docs]
def get_matrix_coefficients(
flux_name: str,
CM: NDArrayFloat,
F: NDArrayFloat,
F_names: list[str],
R_names: list[str],
*,
include_zeros: bool = False,
atol: float = 0.0,
) -> list[tuple[str, float]]:
"""Return reservoir rows affected by a given flux (and their CM coefficients).
A flux corresponds to one column in CM. Reservoirs correspond to rows in CM.
This function finds the column index for `flux_name` in `F_names`, then returns
(reservoir_name, CM[row, col]) for each reservoir row where that coefficient is
non-zero (or all rows if include_zeros=True).
Parameters
----------
flux_name
Name as stored in F_names (e.g., entries produced by f.full_name).
CM
Coefficient matrix with shape (n_reservoir_rows, n_fluxes).
F
Flux value vector with shape (n_fluxes,). (Not required for coefficients,
but kept to match your provided signature and for sanity checks.)
F_names
Flux names aligned with flux indices (columns of CM, entries of F).
R_names
Reservoir row names aligned with row indices of CM.
include_zeros
If True, return all reservoirs with their coefficient (including 0.0).
If False, only return reservoirs with non-zero coefficients.
atol
Absolute tolerance for treating very small coefficients as zero.
Returns
-------
list[tuple[str, float]]
List of (reservoir_name, coefficient) tuples.
"""
if flux_name not in F_names:
raise KeyError(f"Flux name not found in F_names: {flux_name!r}")
col = F_names.index(flux_name)
# Basic alignment checks (optional but helpful)
if CM.shape[1] != len(F_names):
raise ValueError(
f"CM has {CM.shape[1]} columns but F_names has {len(F_names)} entries."
)
if CM.shape[0] != len(R_names):
raise ValueError(
f"CM has {CM.shape[0]} rows but R_names has {len(R_names)} entries."
)
if len(F) != len(F_names):
raise ValueError(f"F has length {len(F)} but F_names has {len(F_names)}.")
coeff_col = CM[:, col]
if include_zeros:
return [(R_names[i], float(coeff_col[i])) for i in range(len(R_names))]
if atol > 0.0:
rows = np.where(np.abs(coeff_col) > atol)[0]
else:
rows = np.nonzero(coeff_col)[0]
return [
(flux_name, R_names[i], f"coeff = {coeff_col[i]:.2e}, val = {F[col]:.2e}")
for i in rows
]